C32H44O9 — CID 142301447
4-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate (PubChem CID 142301447) has the molecular formula C32H44O9 and a molecular weight of 572.70 g/mol. Its IUPAC name is 4-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 142301447 |
| Molecular Formula | C32H44O9 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 4-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C1CCC(C(=O)Oc2ccc(OCCCCCCOC(=O)C=C)cc2)CC1 |
| InChI | InChI=1S/C32H44O9/c1-3-29(33)38-22-10-6-5-9-21-37-27-17-19-28(20-18-27)41-32(36)26-15-13-25(14-16-26)31(35)40-24-12-8-7-11-23-39-30(34)4-2/h3-4,17-20,25-26H,1-2,5-16,21-24H2 |
| InChIKey | QEDCFCFPRWNAOG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|