C30H44N2O7 — CID 134463768
[4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[propan-2-yl(propan-2-ylcarbamoyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 134463768) has the molecular formula C30H44N2O7 and a molecular weight of 544.69 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[propan-2-yl(propan-2-ylcarbamoyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[propan-2-yl(propan-2-ylcarbamoyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134463768 |
| Molecular Formula | C30H44N2O7 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[propan-2-yl(propan-2-ylcarbamoyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)N(C(=O)NC(C)C)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H44N2O7/c1-6-27(33)38-20-10-8-7-9-19-37-25-15-17-26(18-16-25)39-29(35)24-13-11-23(12-14-24)28(34)32(22(4)5)30(36)31-21(2)3/h6,15-18,21-24H,1,7-14,19-20H2,2-5H3,(H,31,36) |
| InChIKey | PMIAMMTXMPPCIO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|