C23H34O5 — CID 145308850
ethane;[4-(3-prop-2-enoyloxypropoxy)phenyl] 4-ethylcyclohexane-1-carboxylate (PubChem CID 145308850) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethane;[4-(3-prop-2-enoyloxypropoxy)phenyl] 4-ethylcyclohexane-1-carboxylate.
| Compound Name | ethane;[4-(3-prop-2-enoyloxypropoxy)phenyl] 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 145308850 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | ethane;[4-(3-prop-2-enoyloxypropoxy)phenyl] 4-ethylcyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCOc1ccc(OC(=O)C2CCC(CC)CC2)cc1.CC |
| InChI | InChI=1S/C21H28O5.C2H6/c1-3-16-6-8-17(9-7-16)21(23)26-19-12-10-18(11-13-19)24-14-5-15-25-20(22)4-2;1-2/h4,10-13,16-17H,2-3,5-9,14-15H2,1H3;1-2H3 |
| InChIKey | DUJNFRCXGWJNFQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|