C33H44O9 — CID 88877914
[4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-buta-1,3-dien-2-yloxypropoxy)cyclohexane-1-carboxylate (PubChem CID 88877914) has the molecular formula C33H44O9 and a molecular weight of 584.71 g/mol. Its IUPAC name is [4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-buta-1,3-dien-2-yloxypropoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-buta-1,3-dien-2-yloxypropoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88877914 |
| Molecular Formula | C33H44O9 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | [4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-buta-1,3-dien-2-yloxypropoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=C)OCCCOC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(OCCCOC(=O)C=C)CC3)cc2)CC1 |
| InChI | InChI=1S/C33H44O9/c1-4-24(3)37-20-6-21-38-27-12-8-25(9-13-27)32(35)41-29-16-18-30(19-17-29)42-33(36)26-10-14-28(15-11-26)39-22-7-23-40-31(34)5-2/h4-5,16-19,25-28H,1-3,6-15,20-23H2 |
| InChIKey | BEHGSZGHQMPJIQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|