C28H34O9 — CID 89116660
[4-[4-(prop-2-enoyloxymethoxy)cyclohexanecarbonyl]oxyphenyl] 4-(prop-2-enoyloxymethyl)cyclohexane-1-carboxylate (PubChem CID 89116660) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is [4-[4-(prop-2-enoyloxymethoxy)cyclohexanecarbonyl]oxyphenyl] 4-(prop-2-enoyloxymethyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[4-(prop-2-enoyloxymethoxy)cyclohexanecarbonyl]oxyphenyl] 4-(prop-2-enoyloxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89116660 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [4-[4-(prop-2-enoyloxymethoxy)cyclohexanecarbonyl]oxyphenyl] 4-(prop-2-enoyloxymethyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCOC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(COC(=O)C=C)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H34O9/c1-3-25(29)33-17-19-5-7-20(8-6-19)27(31)36-23-13-15-24(16-14-23)37-28(32)21-9-11-22(12-10-21)34-18-35-26(30)4-2/h3-4,13-16,19-22H,1-2,5-12,17-18H2 |
| InChIKey | IIKXRUSFMVKFJQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|