C37H52O9 — CID 123552475
[4-[3-oxo-3-[[4-(prop-2-enoyloxymethyl)cyclohexyl]methoxy]prop-1-enyl]phenyl] 4-[5-[(3-methyloxetan-3-yl)methoxy]pentoxy]cyclohexane-1-carboxylate (PubChem CID 123552475) has the molecular formula C37H52O9 and a molecular weight of 640.81 g/mol. Its IUPAC name is [4-[3-oxo-3-[[4-(prop-2-enoyloxymethyl)cyclohexyl]methoxy]prop-1-enyl]phenyl] 4-[5-[(3-methyloxetan-3-yl)methoxy]pentoxy]cyclohexane-1-carboxylate.
| Compound Name | [4-[3-oxo-3-[[4-(prop-2-enoyloxymethyl)cyclohexyl]methoxy]prop-1-enyl]phenyl] 4-[5-[(3-methyloxetan-3-yl)methoxy]pentoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123552475 |
| Molecular Formula | C37H52O9 |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | [4-[3-oxo-3-[[4-(prop-2-enoyloxymethyl)cyclohexyl]methoxy]prop-1-enyl]phenyl] 4-[5-[(3-methyloxetan-3-yl)methoxy]pentoxy]cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCC1CCC(COC(=O)C=Cc2ccc(OC(=O)C3CCC(OCCCCCOCC4(C)COC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C37H52O9/c1-3-34(38)44-23-29-7-9-30(10-8-29)24-45-35(39)20-13-28-11-16-33(17-12-28)46-36(40)31-14-18-32(19-15-31)43-22-6-4-5-21-41-25-37(2)26-42-27-37/h3,11-13,16-17,20,29-32H,1,4-10,14-15,18-19,21-27H2,2H3 |
| InChIKey | UTAIVFJXEFOHNZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|