C22H28O4 — CID 173096976
[4-[(E)-3-oxo-3-propoxyprop-1-enyl]phenyl] 4-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 173096976) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-propoxyprop-1-enyl]phenyl] 4-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-oxo-3-propoxyprop-1-enyl]phenyl] 4-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173096976 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [4-[(E)-3-oxo-3-propoxyprop-1-enyl]phenyl] 4-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC1CCC(C(=O)Oc2ccc(/C=C/C(=O)OCCC)cc2)CC1 |
| InChI | InChI=1S/C22H28O4/c1-3-5-17-6-11-19(12-7-17)22(24)26-20-13-8-18(9-14-20)10-15-21(23)25-16-4-2/h3,8-10,13-15,17,19H,1,4-7,11-12,16H2,2H3/b15-10+ |
| InChIKey | AXUKZMFXDVPROK-XNTDXEJSSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|