C28H36N2O4 — CID 59202609
[4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 59202609) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59202609 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [4-[(E)-3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(/C=C/C(=O)OCCc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C28H36N2O4/c1-2-3-4-20-5-10-23(11-6-20)28(32)34-25-14-7-21(8-15-25)9-16-27(31)33-18-17-22-12-13-24(29)19-26(22)30/h7-9,12-16,19-20,23H,2-6,10-11,17-18,29-30H2,1H3/b16-9+ |
| InChIKey | OQMJKOYEBKHDAZ-CXUHLZMHSA-N |
| XLogP | 5.55 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|