C57H70N2O6 — CID 172728669
[4-[(1E,8E)-5,5-bis[(4-aminophenyl)methyl]-9-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]-3,7-dioxonona-1,8-dienyl]phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 172728669) has the molecular formula C57H70N2O6 and a molecular weight of 879.20 g/mol. Its IUPAC name is [4-[(1E,8E)-5,5-bis[(4-aminophenyl)methyl]-9-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]-3,7-dioxonona-1,8-dienyl]phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-[(1E,8E)-5,5-bis[(4-aminophenyl)methyl]-9-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]-3,7-dioxonona-1,8-dienyl]phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172728669 |
| Molecular Formula | C57H70N2O6 |
| Molecular Weight | 879.20 g/mol |
| Exact Mass | 878.52 |
| IUPAC Name | [4-[(1E,8E)-5,5-bis[(4-aminophenyl)methyl]-9-[4-(4-butylcyclohexanecarbonyl)oxyphenyl]-3,7-dioxonona-1,8-dienyl]phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(/C=C/C(=O)CC(CC(=O)/C=C/c3ccc(OC(=O)C4CCC(CCCC)CC4)cc3)(Cc3ccc(N)cc3)Cc3ccc(N)cc3)cc2)CC1 |
| InChI | InChI=1S/C57H70N2O6/c1-3-5-7-41-9-23-47(24-10-41)55(62)64-53-33-19-43(20-34-53)17-31-51(60)39-57(37-45-13-27-49(58)28-14-45,38-46-15-29-50(59)30-16-46)40-52(61)32-18-44-21-35-54(36-22-44)65-56(63)48-25-11-42(12-26-48)8-6-4-2/h13-22,27-36,41-42,47-48H,3-12,23-26,37-40,58-59H2,1-2H3/b31-17+,32-18+ |
| InChIKey | HMMWFPZHDXUIHF-LTTYKRRRSA-N |
| XLogP | 12.77 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.20 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|