C31H46O4 — CID 176858001
[4-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 176858001) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is [4-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 176858001 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | [4-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(/C=C/C(=O)OC(C)(C)C)cc3)CC2)CC1 |
| InChI | InChI=1S/C31H46O4/c1-5-6-7-8-23-9-14-25(15-10-23)26-16-18-27(19-17-26)30(33)34-28-20-11-24(12-21-28)13-22-29(32)35-31(2,3)4/h11-13,20-23,25-27H,5-10,14-19H2,1-4H3/b22-13+ |
| InChIKey | HXYDTRVVMNCPDU-LPYMAVHISA-N |
| XLogP | 8.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|