C30H42O5 — CID 176858013
[4-[(E)-3-(oxiran-2-ylmethoxy)-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 176858013) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is [4-[(E)-3-(oxiran-2-ylmethoxy)-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-(oxiran-2-ylmethoxy)-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 176858013 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | [4-[(E)-3-(oxiran-2-ylmethoxy)-3-oxoprop-1-enyl]phenyl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(/C=C/C(=O)OCC4CO4)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H42O5/c1-2-3-4-5-22-6-11-24(12-7-22)25-13-15-26(16-14-25)30(32)35-27-17-8-23(9-18-27)10-19-29(31)34-21-28-20-33-28/h8-10,17-19,22,24-26,28H,2-7,11-16,20-21H2,1H3/b19-10+ |
| InChIKey | IIPJPMKHYNKNRT-VXLYETTFSA-N |
| XLogP | 6.74 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|