C30H38N2O6 — CID 91068956
3,5-diamino-4-[4-[3-[4-(4-propylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]butyl]benzoic acid (PubChem CID 91068956) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is 3,5-diamino-4-[4-[3-[4-(4-propylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]butyl]benzoic acid.
| Compound Name | 3,5-diamino-4-[4-[3-[4-(4-propylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]butyl]benzoic acid |
|---|---|
| PubChem CID | 91068956 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 3,5-diamino-4-[4-[3-[4-(4-propylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]butyl]benzoic acid |
| SMILES | CCCC1CCC(C(=O)Oc2ccc(C=CC(=O)OCCCCc3c(N)cc(C(=O)O)cc3N)cc2)CC1 |
| InChI | InChI=1S/C30H38N2O6/c1-2-5-20-7-12-22(13-8-20)30(36)38-24-14-9-21(10-15-24)11-16-28(33)37-17-4-3-6-25-26(31)18-23(29(34)35)19-27(25)32/h9-11,14-16,18-20,22H,2-8,12-13,17,31-32H2,1H3,(H,34,35) |
| InChIKey | YDXMERFFSXLZAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|