C31H40N2O6 — CID 68611336
6-[3-[4-(4-ethylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate (PubChem CID 68611336) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is 6-[3-[4-(4-ethylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate.
| Compound Name | 6-[3-[4-(4-ethylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68611336 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 6-[3-[4-(4-ethylcyclohexanecarbonyl)oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
| SMILES | CCC1CCC(C(=O)Oc2ccc(C=CC(=O)OCCCCCCOC(=O)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C31H40N2O6/c1-2-22-7-12-24(13-8-22)31(36)39-28-14-9-23(10-15-28)11-16-29(34)37-17-5-3-4-6-18-38-30(35)25-19-26(32)21-27(33)20-25/h9-11,14-16,19-22,24H,2-8,12-13,17-18,32-33H2,1H3 |
| InChIKey | RSRLQBITFOGJPS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|