C35H42N2O7 — CID 68529989
8-[4-[(E)-3-(4-butoxyphenoxy)-3-oxoprop-1-enyl]benzoyl]oxyoctyl 3,5-diaminobenzoate (PubChem CID 68529989) has the molecular formula C35H42N2O7 and a molecular weight of 602.73 g/mol. Its IUPAC name is 8-[4-[(E)-3-(4-butoxyphenoxy)-3-oxoprop-1-enyl]benzoyl]oxyoctyl 3,5-diaminobenzoate.
| Compound Name | 8-[4-[(E)-3-(4-butoxyphenoxy)-3-oxoprop-1-enyl]benzoyl]oxyoctyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68529989 |
| Molecular Formula | C35H42N2O7 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 8-[4-[(E)-3-(4-butoxyphenoxy)-3-oxoprop-1-enyl]benzoyl]oxyoctyl 3,5-diaminobenzoate |
| SMILES | CCCCOc1ccc(OC(=O)/C=C/c2ccc(C(=O)OCCCCCCCCOC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C35H42N2O7/c1-2-3-20-41-31-15-17-32(18-16-31)44-33(38)19-12-26-10-13-27(14-11-26)34(39)42-21-8-6-4-5-7-9-22-43-35(40)28-23-29(36)25-30(37)24-28/h10-19,23-25H,2-9,20-22,36-37H2,1H3/b19-12+ |
| InChIKey | IXMLDVBMTVMCIJ-XDHOZWIPSA-N |
| XLogP | 7.00 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|