C34H39NO7 — CID 143211192
[6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3-amino-5-methylbenzoate (PubChem CID 143211192) has the molecular formula C34H39NO7 and a molecular weight of 573.69 g/mol. Its IUPAC name is [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3-amino-5-methylbenzoate.
| Compound Name | [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3-amino-5-methylbenzoate |
|---|---|
| PubChem CID | 143211192 |
| Molecular Formula | C34H39NO7 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3-amino-5-methylbenzoate |
| SMILES | CCCCCOc1ccc(OC(=O)/C=C/c2ccc(OC(=O)CCCCCOC(=O)c3cc(C)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C34H39NO7/c1-3-4-7-20-39-29-15-17-31(18-16-29)42-33(37)19-12-26-10-13-30(14-11-26)41-32(36)9-6-5-8-21-40-34(38)27-22-25(2)23-28(35)24-27/h10-19,22-24H,3-9,20-21,35H2,1-2H3/b19-12+ |
| InChIKey | YNYJYTXUBUAHPW-XDHOZWIPSA-N |
| XLogP | 7.09 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|