C35H40N2O8 — CID 68528624
7-[4-[3-oxo-3-(4-pentanoyloxyphenoxy)prop-1-enyl]benzoyl]oxyheptyl 3,5-diaminobenzoate (PubChem CID 68528624) has the molecular formula C35H40N2O8 and a molecular weight of 616.71 g/mol. Its IUPAC name is 7-[4-[3-oxo-3-(4-pentanoyloxyphenoxy)prop-1-enyl]benzoyl]oxyheptyl 3,5-diaminobenzoate.
| Compound Name | 7-[4-[3-oxo-3-(4-pentanoyloxyphenoxy)prop-1-enyl]benzoyl]oxyheptyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 68528624 |
| Molecular Formula | C35H40N2O8 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 7-[4-[3-oxo-3-(4-pentanoyloxyphenoxy)prop-1-enyl]benzoyl]oxyheptyl 3,5-diaminobenzoate |
| SMILES | CCCCC(=O)Oc1ccc(OC(=O)C=Cc2ccc(C(=O)OCCCCCCCOC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C35H40N2O8/c1-2-3-9-32(38)44-30-15-17-31(18-16-30)45-33(39)19-12-25-10-13-26(14-11-25)34(40)42-20-7-5-4-6-8-21-43-35(41)27-22-28(36)24-29(37)23-27/h10-19,22-24H,2-9,20-21,36-37H2,1H3 |
| InChIKey | OHZJEYXKNSQJLP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|