C33H38N2O7 — CID 59217447
[6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3,5-diaminobenzoate (PubChem CID 59217447) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3,5-diaminobenzoate.
| Compound Name | [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 59217447 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [6-oxo-6-[4-[(E)-3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]hexyl] 3,5-diaminobenzoate |
| SMILES | CCCCCOc1ccc(OC(=O)/C=C/c2ccc(OC(=O)CCCCCOC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O7/c1-2-3-6-19-39-28-14-16-30(17-15-28)42-32(37)18-11-24-9-12-29(13-10-24)41-31(36)8-5-4-7-20-40-33(38)25-21-26(34)23-27(35)22-25/h9-18,21-23H,2-8,19-20,34-35H2,1H3/b18-11+ |
| InChIKey | ATUSBKDJAZGNQC-WOJGMQOQSA-N |
| XLogP | 6.36 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|