C36H47F5N2O5 — CID 87514723
8-[(E)-3-[4-[[4-(4,4,5,5,5-pentafluoropentyl)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyoctyl 3,5-diaminobenzoate (PubChem CID 87514723) has the molecular formula C36H47F5N2O5 and a molecular weight of 682.77 g/mol. Its IUPAC name is 8-[(E)-3-[4-[[4-(4,4,5,5,5-pentafluoropentyl)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyoctyl 3,5-diaminobenzoate.
| Compound Name | 8-[(E)-3-[4-[[4-(4,4,5,5,5-pentafluoropentyl)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyoctyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 87514723 |
| Molecular Formula | C36H47F5N2O5 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | 8-[(E)-3-[4-[[4-(4,4,5,5,5-pentafluoropentyl)cyclohexyl]methoxy]phenyl]prop-2-enoyl]oxyoctyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCCCOC(=O)/C=C/c2ccc(OCC3CCC(CCCC(F)(F)C(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C36H47F5N2O5/c37-35(38,36(39,40)41)19-7-8-26-9-11-28(12-10-26)25-48-32-16-13-27(14-17-32)15-18-33(44)46-20-5-3-1-2-4-6-21-47-34(45)29-22-30(42)24-31(43)23-29/h13-18,22-24,26,28H,1-12,19-21,25,42-43H2/b18-15+ |
| InChIKey | URLSNVUHHIZZIG-OBGWFSINSA-N |
| XLogP | 9.16 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|