C34H35F5N2O7 — CID 76720961
6-[3-[4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate (PubChem CID 76720961) has the molecular formula C34H35F5N2O7 and a molecular weight of 678.65 g/mol. Its IUPAC name is 6-[3-[4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate.
| Compound Name | 6-[3-[4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 76720961 |
| Molecular Formula | C34H35F5N2O7 |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 6-[3-[4-[4-(4,4,5,5,5-pentafluoropentoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]hexyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCCCC(F)(F)C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C34H35F5N2O7/c35-33(36,34(37,38)39)16-5-19-45-28-13-9-24(10-14-28)32(44)48-29-11-6-23(7-12-29)8-15-30(42)46-17-3-1-2-4-18-47-31(43)25-20-26(40)22-27(41)21-25/h6-15,20-22H,1-5,16-19,40-41H2 |
| InChIKey | LLPXRYJILAALJR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|