C30H29F3N2O7 — CID 66823249
5-[(E)-3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypentyl 3,5-diaminobenzoate (PubChem CID 66823249) has the molecular formula C30H29F3N2O7 and a molecular weight of 586.56 g/mol. Its IUPAC name is 5-[(E)-3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypentyl 3,5-diaminobenzoate.
| Compound Name | 5-[(E)-3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypentyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 66823249 |
| Molecular Formula | C30H29F3N2O7 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 5-[(E)-3-[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypentyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C30H29F3N2O7/c31-30(32,33)19-41-25-11-7-21(8-12-25)29(38)42-26-9-4-20(5-10-26)6-13-27(36)39-14-2-1-3-15-40-28(37)22-16-23(34)18-24(35)17-22/h4-13,16-18H,1-3,14-15,19,34-35H2/b13-6+ |
| InChIKey | FTWMZTLEEFIHDB-AWNIVKPZSA-N |
| XLogP | 5.59 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|