C26H21F3N2O6 — CID 66823302
2-[3-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate (PubChem CID 66823302) has the molecular formula C26H21F3N2O6 and a molecular weight of 514.46 g/mol. Its IUPAC name is 2-[3-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate.
| Compound Name | 2-[3-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 66823302 |
| Molecular Formula | C26H21F3N2O6 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[3-[4-[4-(trifluoromethyl)benzoyl]oxyphenyl]prop-2-enoyloxy]ethyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C26H21F3N2O6/c27-26(28,29)19-6-4-17(5-7-19)25(34)37-22-8-1-16(2-9-22)3-10-23(32)35-11-12-36-24(33)18-13-20(30)15-21(31)14-18/h1-10,13-15H,11-12,30-31H2 |
| InChIKey | BYKDSPPIPWFZHH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|