C27H23F3N2O7 — CID 87168839
2-[(E)-3-[4-[4-(1,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate (PubChem CID 87168839) has the molecular formula C27H23F3N2O7 and a molecular weight of 544.48 g/mol. Its IUPAC name is 2-[(E)-3-[4-[4-(1,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate.
| Compound Name | 2-[(E)-3-[4-[4-(1,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 87168839 |
| Molecular Formula | C27H23F3N2O7 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 2-[(E)-3-[4-[4-(1,2,2-trifluoroethoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OC(F)C(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C27H23F3N2O7/c28-24(29)25(30)38-21-8-4-17(5-9-21)27(35)39-22-6-1-16(2-7-22)3-10-23(33)36-11-12-37-26(34)18-13-19(31)15-20(32)14-18/h1-10,13-15,24-25H,11-12,31-32H2/b10-3+ |
| InChIKey | GJAASFWKLWTNAC-XCVCLJGOSA-N |
| XLogP | 4.42 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|