C34H37F3N2O7 — CID 66822365
7-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyheptyl 3,5-diaminobenzoate (PubChem CID 66822365) has the molecular formula C34H37F3N2O7 and a molecular weight of 642.67 g/mol. Its IUPAC name is 7-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyheptyl 3,5-diaminobenzoate.
| Compound Name | 7-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyheptyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 66822365 |
| Molecular Formula | C34H37F3N2O7 |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | 7-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxyheptyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C34H37F3N2O7/c35-34(36,37)17-6-20-43-29-14-10-25(11-15-29)33(42)46-30-12-7-24(8-13-30)9-16-31(40)44-18-4-2-1-3-5-19-45-32(41)26-21-27(38)23-28(39)22-26/h7-16,21-23H,1-6,17-20,38-39H2/b16-9+ |
| InChIKey | UPDWMYXJGBZTBB-CXUHLZMHSA-N |
| XLogP | 7.16 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|