C34H37F5N2O6 — CID 89400863
6-[(E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxyhexyl 3,5-diaminobenzoate (PubChem CID 89400863) has the molecular formula C34H37F5N2O6 and a molecular weight of 664.67 g/mol. Its IUPAC name is 6-[(E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxyhexyl 3,5-diaminobenzoate.
| Compound Name | 6-[(E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxyhexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 89400863 |
| Molecular Formula | C34H37F5N2O6 |
| Molecular Weight | 664.67 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 6-[(E)-3-[4-[difluoro-[4-(5,5,5-trifluoropentoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxyhexyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCOC(=O)/C=C/c2ccc(OC(F)(F)c3ccc(OCCCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C34H37F5N2O6/c35-33(36,37)17-3-6-18-44-29-14-10-26(11-15-29)34(38,39)47-30-12-7-24(8-13-30)9-16-31(42)45-19-4-1-2-5-20-46-32(43)25-21-27(40)23-28(41)22-25/h7-16,21-23H,1-6,17-20,40-41H2/b16-9+ |
| InChIKey | OEIFVADJASCVLN-CXUHLZMHSA-N |
| XLogP | 8.06 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|