C30H29F5N2O6 — CID 89401170
4-[(E)-3-[4-[difluoro-[4-(3,3,3-trifluoropropoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate (PubChem CID 89401170) has the molecular formula C30H29F5N2O6 and a molecular weight of 608.56 g/mol. Its IUPAC name is 4-[(E)-3-[4-[difluoro-[4-(3,3,3-trifluoropropoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate.
| Compound Name | 4-[(E)-3-[4-[difluoro-[4-(3,3,3-trifluoropropoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 89401170 |
| Molecular Formula | C30H29F5N2O6 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 4-[(E)-3-[4-[difluoro-[4-(3,3,3-trifluoropropoxy)phenyl]methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCOC(=O)/C=C/c2ccc(OC(F)(F)c3ccc(OCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C30H29F5N2O6/c31-29(32,33)13-16-40-25-10-6-22(7-11-25)30(34,35)43-26-8-3-20(4-9-26)5-12-27(38)41-14-1-2-15-42-28(39)21-17-23(36)19-24(37)18-21/h3-12,17-19H,1-2,13-16,36-37H2/b12-5+ |
| InChIKey | MGNVWLSNDCEVSU-LFYBBSHMSA-N |
| XLogP | 6.50 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|