C30H29F2N3O6 — CID 89400860
3-[(E)-3-[4-[[4-(3-cyanopropoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate (PubChem CID 89400860) has the molecular formula C30H29F2N3O6 and a molecular weight of 565.57 g/mol. Its IUPAC name is 3-[(E)-3-[4-[[4-(3-cyanopropoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate.
| Compound Name | 3-[(E)-3-[4-[[4-(3-cyanopropoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 89400860 |
| Molecular Formula | C30H29F2N3O6 |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 3-[(E)-3-[4-[[4-(3-cyanopropoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyl]oxypropyl 3,5-diaminobenzoate |
| SMILES | N#CCCCOc1ccc(C(F)(F)Oc2ccc(/C=C/C(=O)OCCCOC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C30H29F2N3O6/c31-30(32,23-7-11-26(12-8-23)38-15-2-1-14-33)41-27-9-4-21(5-10-27)6-13-28(36)39-16-3-17-40-29(37)22-18-24(34)20-25(35)19-22/h4-13,18-20H,1-3,15-17,34-35H2/b13-6+ |
| InChIKey | AHCPLBFZRJEXAA-AWNIVKPZSA-N |
| XLogP | 5.47 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|