C33H31F2N3O10 — CID 89401460
6-[(E)-3-[4-[[4-(3-cyanopropoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoyl]oxyhexyl 3,5-dinitrobenzoate (PubChem CID 89401460) has the molecular formula C33H31F2N3O10 and a molecular weight of 667.62 g/mol. Its IUPAC name is 6-[(E)-3-[4-[[4-(3-cyanopropoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoyl]oxyhexyl 3,5-dinitrobenzoate.
| Compound Name | 6-[(E)-3-[4-[[4-(3-cyanopropoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoyl]oxyhexyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 89401460 |
| Molecular Formula | C33H31F2N3O10 |
| Molecular Weight | 667.62 g/mol |
| Exact Mass | 667.20 |
| IUPAC Name | 6-[(E)-3-[4-[[4-(3-cyanopropoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoyl]oxyhexyl 3,5-dinitrobenzoate |
| SMILES | N#CCCCOc1ccc(OC(F)(F)c2ccc(/C=C/C(=O)OCCCCCCOC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C33H31F2N3O10/c34-33(35,48-30-14-12-29(13-15-30)45-18-6-3-17-36)26-10-7-24(8-11-26)9-16-31(39)46-19-4-1-2-5-20-47-32(40)25-21-27(37(41)42)23-28(22-25)38(43)44/h7-16,21-23H,1-6,18-20H2/b16-9+ |
| InChIKey | CJYGVLRJYUYGAG-CXUHLZMHSA-N |
| XLogP | 7.29 |
| TPSA | 181.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|