C32H33F2N3O6 — CID 123844393
3,5-diamino-2-[2-[3-[4-[[4-(6-cyanohexoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid (PubChem CID 123844393) has the molecular formula C32H33F2N3O6 and a molecular weight of 593.63 g/mol. Its IUPAC name is 3,5-diamino-2-[2-[3-[4-[[4-(6-cyanohexoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[2-[3-[4-[[4-(6-cyanohexoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 123844393 |
| Molecular Formula | C32H33F2N3O6 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 3,5-diamino-2-[2-[3-[4-[[4-(6-cyanohexoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
| SMILES | N#CCCCCCCOc1ccc(C(F)(F)Oc2ccc(C=CC(=O)OCCc3c(N)cc(N)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H33F2N3O6/c33-32(34,23-9-13-25(14-10-23)41-18-5-3-1-2-4-17-35)43-26-11-6-22(7-12-26)8-15-30(38)42-19-16-27-28(31(39)40)20-24(36)21-29(27)37/h6-15,20-21H,1-5,16,18-19,36-37H2,(H,39,40) |
| InChIKey | XZQLRUCDTKMVCA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|