C32H40F2N2O5 — CID 123884037
3,5-diamino-2-[2-[3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid (PubChem CID 123884037) has the molecular formula C32H40F2N2O5 and a molecular weight of 570.68 g/mol. Its IUPAC name is 3,5-diamino-2-[2-[3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[2-[3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 123884037 |
| Molecular Formula | C32H40F2N2O5 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 3,5-diamino-2-[2-[3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
| SMILES | CCCCCC12CCC(C(F)(F)Oc3ccc(C=CC(=O)OCCc4c(N)cc(N)cc4C(=O)O)cc3)(CC1)CC2 |
| InChI | InChI=1S/C32H40F2N2O5/c1-2-3-4-12-30-13-16-31(17-14-30,18-15-30)32(33,34)41-24-8-5-22(6-9-24)7-10-28(37)40-19-11-25-26(29(38)39)20-23(35)21-27(25)36/h5-10,20-21H,2-4,11-19,35-36H2,1H3,(H,38,39) |
| InChIKey | VKFWHLVIMUAGOZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|