C27H34N2O5 — CID 90872974
3,5-diamino-2-[2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid (PubChem CID 90872974) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3,5-diamino-2-[2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 90872974 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 3,5-diamino-2-[2-[3-[4-[(4-ethylcyclohexyl)methoxy]phenyl]prop-2-enoyloxy]ethyl]benzoic acid |
| SMILES | CCC1CCC(COc2ccc(C=CC(=O)OCCc3c(N)cc(N)cc3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O5/c1-2-18-3-5-20(6-4-18)17-34-22-10-7-19(8-11-22)9-12-26(30)33-14-13-23-24(27(31)32)15-21(28)16-25(23)29/h7-12,15-16,18,20H,2-6,13-14,17,28-29H2,1H3,(H,31,32) |
| InChIKey | RQFLCEKATZWVPY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|