C24H24N2O3 — CID 144577600
2-(2,4-diaminophenyl)ethyl (E)-3-[4-(4-methoxyphenyl)phenyl]prop-2-enoate (PubChem CID 144577600) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(2,4-diaminophenyl)ethyl (E)-3-[4-(4-methoxyphenyl)phenyl]prop-2-enoate.
| Compound Name | 2-(2,4-diaminophenyl)ethyl (E)-3-[4-(4-methoxyphenyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 144577600 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(2,4-diaminophenyl)ethyl (E)-3-[4-(4-methoxyphenyl)phenyl]prop-2-enoate |
| SMILES | COc1ccc(-c2ccc(/C=C/C(=O)OCCc3ccc(N)cc3N)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-28-22-11-8-19(9-12-22)18-5-2-17(3-6-18)4-13-24(27)29-15-14-20-7-10-21(25)16-23(20)26/h2-13,16H,14-15,25-26H2,1H3/b13-4+ |
| InChIKey | FFUBZZFKRRVAMS-YIXHJXPBSA-N |
| XLogP | 4.33 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|