C19H20N2O5 — CID 144577578
2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl 3,5-diaminobenzoate (PubChem CID 144577578) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl 3,5-diaminobenzoate.
| Compound Name | 2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 144577578 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl 3,5-diaminobenzoate |
| SMILES | COc1ccc(/C=C/C(=O)OCCOC(=O)c2cc(N)cc(N)c2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-24-17-5-2-13(3-6-17)4-7-18(22)25-8-9-26-19(23)14-10-15(20)12-16(21)11-14/h2-7,10-12H,8-9,20-21H2,1H3/b7-4+ |
| InChIKey | XYKFJMWBRZIRMH-QPJJXVBHSA-N |
| XLogP | 2.27 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|