C40H46N2O6 — CID 59217453
6-[4-[(E)-3-oxo-3-[6-(4-phenylphenoxy)hexoxy]prop-1-enyl]phenoxy]hexyl 3,5-diaminobenzoate (PubChem CID 59217453) has the molecular formula C40H46N2O6 and a molecular weight of 650.82 g/mol. Its IUPAC name is 6-[4-[(E)-3-oxo-3-[6-(4-phenylphenoxy)hexoxy]prop-1-enyl]phenoxy]hexyl 3,5-diaminobenzoate.
| Compound Name | 6-[4-[(E)-3-oxo-3-[6-(4-phenylphenoxy)hexoxy]prop-1-enyl]phenoxy]hexyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 59217453 |
| Molecular Formula | C40H46N2O6 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 6-[4-[(E)-3-oxo-3-[6-(4-phenylphenoxy)hexoxy]prop-1-enyl]phenoxy]hexyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCCCOc2ccc(/C=C/C(=O)OCCCCCCOc3ccc(-c4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H46N2O6/c41-35-28-34(29-36(42)30-35)40(44)48-27-11-4-2-9-24-45-37-19-14-31(15-20-37)16-23-39(43)47-26-10-3-1-8-25-46-38-21-17-33(18-22-38)32-12-6-5-7-13-32/h5-7,12-23,28-30H,1-4,8-11,24-27,41-42H2/b23-16+ |
| InChIKey | CXOVPSHWWPDQCU-XQNSMLJCSA-N |
| XLogP | 8.51 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|