C31H31F3N2O7 — CID 66822873
4-[3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]butyl 3,5-diaminobenzoate (PubChem CID 66822873) has the molecular formula C31H31F3N2O7 and a molecular weight of 600.59 g/mol. Its IUPAC name is 4-[3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]butyl 3,5-diaminobenzoate.
| Compound Name | 4-[3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]butyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 66822873 |
| Molecular Formula | C31H31F3N2O7 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 4-[3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyloxy]butyl 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OCCCCOC(=O)C=Cc2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C31H31F3N2O7/c32-31(33,34)14-3-17-40-26-11-7-22(8-12-26)30(39)43-27-9-4-21(5-10-27)6-13-28(37)41-15-1-2-16-42-29(38)23-18-24(35)20-25(36)19-23/h4-13,18-20H,1-3,14-17,35-36H2 |
| InChIKey | MTDYPUDSNLRBPZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|