C27H31F3O5 — CID 91482458
[4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(5,5,5-trifluoropentoxy)benzoate (PubChem CID 91482458) has the molecular formula C27H31F3O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(5,5,5-trifluoropentoxy)benzoate.
| Compound Name | [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(5,5,5-trifluoropentoxy)benzoate |
|---|---|
| PubChem CID | 91482458 |
| Molecular Formula | C27H31F3O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [4-(3-hexoxy-3-oxoprop-1-enyl)phenyl] 4-(5,5,5-trifluoropentoxy)benzoate |
| SMILES | CCCCCCOC(=O)C=Cc1ccc(OC(=O)c2ccc(OCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H31F3O5/c1-2-3-4-6-20-34-25(31)17-10-21-8-13-24(14-9-21)35-26(32)22-11-15-23(16-12-22)33-19-7-5-18-27(28,29)30/h8-17H,2-7,18-20H2,1H3 |
| InChIKey | FDHITWKBJKKLJO-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|