C28H33F3O7 — CID 91455951
[4-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate (PubChem CID 91455951) has the molecular formula C28H33F3O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is [4-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate.
| Compound Name | [4-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate |
|---|---|
| PubChem CID | 91455951 |
| Molecular Formula | C28H33F3O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | [4-[3-[2-(2-ethoxyethoxy)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate |
| SMILES | CCOCCOCCOC(=O)C=Cc1ccc(OC(=O)c2ccc(OCCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H33F3O7/c1-2-34-18-19-35-20-21-37-26(32)15-8-22-6-11-25(12-7-22)38-27(33)23-9-13-24(14-10-23)36-17-5-3-4-16-28(29,30)31/h6-15H,2-5,16-21H2,1H3 |
| InChIKey | WVVQFNROEVGQDN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|