C26H29F3O6 — CID 91803918
[4-[3-(2-ethoxyethoxy)-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate (PubChem CID 91803918) has the molecular formula C26H29F3O6 and a molecular weight of 494.51 g/mol. Its IUPAC name is [4-[3-(2-ethoxyethoxy)-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate.
| Compound Name | [4-[3-(2-ethoxyethoxy)-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate |
|---|---|
| PubChem CID | 91803918 |
| Molecular Formula | C26H29F3O6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [4-[3-(2-ethoxyethoxy)-3-oxoprop-1-enyl]phenyl] 4-(6,6,6-trifluorohexoxy)benzoate |
| SMILES | CCOCCOC(=O)C=Cc1ccc(OC(=O)c2ccc(OCCCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H29F3O6/c1-2-32-18-19-34-24(30)15-8-20-6-11-23(12-7-20)35-25(31)21-9-13-22(14-10-21)33-17-5-3-4-16-26(27,28)29/h6-15H,2-5,16-19H2,1H3 |
| InChIKey | OUZKEUYUSYXOHM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|