C28H25F3O5 — CID 163559377
[4-[(E)-3-oxo-3-(2-phenylethoxy)prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 163559377) has the molecular formula C28H25F3O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-(2-phenylethoxy)prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-oxo-3-(2-phenylethoxy)prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 163559377 |
| Molecular Formula | C28H25F3O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [4-[(E)-3-oxo-3-(2-phenylethoxy)prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)OCCc1ccccc1 |
| InChI | InChI=1S/C28H25F3O5/c29-28(30,31)18-4-19-34-24-14-10-23(11-15-24)27(33)36-25-12-7-22(8-13-25)9-16-26(32)35-20-17-21-5-2-1-3-6-21/h1-3,5-16H,4,17-20H2/b16-9+ |
| InChIKey | FPXCUGWSXSPCPF-CXUHLZMHSA-N |
| XLogP | 6.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|