C20H16F3IO4 — CID 155479567
[4-[(E)-3-iodo-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 155479567) has the molecular formula C20H16F3IO4 and a molecular weight of 504.24 g/mol. Its IUPAC name is [4-[(E)-3-iodo-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-iodo-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 155479567 |
| Molecular Formula | C20H16F3IO4 |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | [4-[(E)-3-iodo-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | O=C(I)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H16F3IO4/c21-20(22,23)12-1-13-27-16-9-5-15(6-10-16)19(26)28-17-7-2-14(3-8-17)4-11-18(24)25/h2-11H,1,12-13H2/b11-4+ |
| InChIKey | WJLHQFBCHCKVFV-NYYWCZLTSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|