C25H23F3N2O3 — CID 142716757
[4-[2-(2,4-diaminophenyl)ethenyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 142716757) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is [4-[2-(2,4-diaminophenyl)ethenyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[2-(2,4-diaminophenyl)ethenyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 142716757 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [4-[2-(2,4-diaminophenyl)ethenyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | Nc1ccc(C=Cc2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)c(N)c1 |
| InChI | InChI=1S/C25H23F3N2O3/c26-25(27,28)14-1-15-32-21-12-7-19(8-13-21)24(31)33-22-10-3-17(4-11-22)2-5-18-6-9-20(29)16-23(18)30/h2-13,16H,1,14-15,29-30H2 |
| InChIKey | CZQUJCMPFKJZEA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|