C28H27F3N2O5 — CID 175184893
[4-[2-(2,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 175184893) has the molecular formula C28H27F3N2O5 and a molecular weight of 528.53 g/mol. Its IUPAC name is [4-[2-(2,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[2-(2,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 175184893 |
| Molecular Formula | C28H27F3N2O5 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [4-[2-(2,5-diaminophenyl)-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | CCOC(=O)C(=Cc1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)c1cc(N)ccc1N |
| InChI | InChI=1S/C28H27F3N2O5/c1-2-36-27(35)24(23-17-20(32)8-13-25(23)33)16-18-4-9-22(10-5-18)38-26(34)19-6-11-21(12-7-19)37-15-3-14-28(29,30)31/h4-13,16-17H,2-3,14-15,32-33H2,1H3 |
| InChIKey | NDXJAVOGIFDSNW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|