C28H27F3N2O5 — CID 66823415
2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(5,5,5-trifluoropentoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 66823415) has the molecular formula C28H27F3N2O5 and a molecular weight of 528.53 g/mol. Its IUPAC name is 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(5,5,5-trifluoropentoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(5,5,5-trifluoropentoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66823415 |
| Molecular Formula | C28H27F3N2O5 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(5,5,5-trifluoropentoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | Nc1cc(N)cc(CC(=Cc2ccc(OC(=O)c3ccc(OCCCCC(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C28H27F3N2O5/c29-28(30,31)11-1-2-12-37-24-9-5-20(6-10-24)27(36)38-25-7-3-18(4-8-25)13-21(26(34)35)14-19-15-22(32)17-23(33)16-19/h3-10,13,15-17H,1-2,11-12,14,32-33H2,(H,34,35) |
| InChIKey | CZQJTGKXASZSOS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|