C29H23F9N2O5 — CID 173022254
2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 173022254) has the molecular formula C29H23F9N2O5 and a molecular weight of 650.49 g/mol. Its IUPAC name is 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173022254 |
| Molecular Formula | C29H23F9N2O5 |
| Molecular Weight | 650.49 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | Nc1cc(N)cc(CC(=Cc2ccc(OC(=O)c3ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C29H23F9N2O5/c30-26(31,27(32,33)28(34,35)29(36,37)38)9-10-44-22-7-3-18(4-8-22)25(43)45-23-5-1-16(2-6-23)11-19(24(41)42)12-17-13-20(39)15-21(40)14-17/h1-8,11,13-15H,9-10,12,39-40H2,(H,41,42) |
| InChIKey | ZDDDHZKNFZJHFK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|