C38H33F17O5 — CID 101148784
[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 101148784) has the molecular formula C38H33F17O5 and a molecular weight of 892.64 g/mol. Its IUPAC name is [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101148784 |
| Molecular Formula | C38H33F17O5 |
| Molecular Weight | 892.64 g/mol |
| Exact Mass | 892.21 |
| IUPAC Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H33F17O5/c1-2-3-4-5-6-7-21-58-27-16-12-24(13-17-27)23-8-10-26(11-9-23)30(57)60-28-18-14-25(15-19-28)29(56)59-22-20-31(39,40)32(41,42)33(43,44)34(45,46)35(47,48)36(49,50)37(51,52)38(53,54)55/h8-19H,2-7,20-22H2,1H3 |
| InChIKey | ARNYEIFMVVAXBS-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.64 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|