C25H25F17O3 — CID 100925120
octyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzoate (PubChem CID 100925120) has the molecular formula C25H25F17O3 and a molecular weight of 696.44 g/mol. Its IUPAC name is octyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzoate.
| Compound Name | octyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzoate |
|---|---|
| PubChem CID | 100925120 |
| Molecular Formula | C25H25F17O3 |
| Molecular Weight | 696.44 g/mol |
| Exact Mass | 696.15 |
| IUPAC Name | octyl 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzoate |
| SMILES | CCCCCCCCOC(=O)c1ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H25F17O3/c1-2-3-4-5-6-7-13-45-17(43)15-8-10-16(11-9-15)44-14-12-18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42/h8-11H,2-7,12-14H2,1H3 |
| InChIKey | NEFDISHIVVJILW-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.44 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|