C17H17F7O4 — CID 91743507
4-O-(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-pentyl benzene-1,4-dicarboxylate (PubChem CID 91743507) has the molecular formula C17H17F7O4 and a molecular weight of 418.31 g/mol. Its IUPAC name is 4-O-(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-pentyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-pentyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91743507 |
| Molecular Formula | C17H17F7O4 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-O-(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-pentyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCOC(=O)c1ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F7O4/c1-2-3-4-9-27-13(25)11-5-7-12(8-6-11)14(26)28-10-15(18,19)16(20,21)17(22,23)24/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | WKCXVGTYCRCOOZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|