C16H19F3O4 — CID 91736771
1-O-hexyl 4-O-(2,2,2-trifluoroethyl) benzene-1,4-dicarboxylate (PubChem CID 91736771) has the molecular formula C16H19F3O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-O-hexyl 4-O-(2,2,2-trifluoroethyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-hexyl 4-O-(2,2,2-trifluoroethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91736771 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-O-hexyl 4-O-(2,2,2-trifluoroethyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3O4/c1-2-3-4-5-10-22-14(20)12-6-8-13(9-7-12)15(21)23-11-16(17,18)19/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | ZWKVLKLMLKCYPG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|