C19H25F3O4 — CID 91736740
1-O-nonyl 2-O-(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate (PubChem CID 91736740) has the molecular formula C19H25F3O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-O-nonyl 2-O-(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-nonyl 2-O-(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91736740 |
| Molecular Formula | C19H25F3O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-O-nonyl 2-O-(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccccc1C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C19H25F3O4/c1-2-3-4-5-6-7-10-13-25-17(23)15-11-8-9-12-16(15)18(24)26-14-19(20,21)22/h8-9,11-12H,2-7,10,13-14H2,1H3 |
| InChIKey | ZXOKVYYXBTZEGA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|