C18H21F5O4 — CID 91740717
1-O-heptyl 4-O-(2,2,3,3,3-pentafluoropropyl) benzene-1,4-dicarboxylate (PubChem CID 91740717) has the molecular formula C18H21F5O4 and a molecular weight of 396.35 g/mol. Its IUPAC name is 1-O-heptyl 4-O-(2,2,3,3,3-pentafluoropropyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-heptyl 4-O-(2,2,3,3,3-pentafluoropropyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91740717 |
| Molecular Formula | C18H21F5O4 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-O-heptyl 4-O-(2,2,3,3,3-pentafluoropropyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc(C(=O)OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F5O4/c1-2-3-4-5-6-11-26-15(24)13-7-9-14(10-8-13)16(25)27-12-17(19,20)18(21,22)23/h7-10H,2-6,11-12H2,1H3 |
| InChIKey | SHHLMRNRBRZARP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|