C28H27F13O3 — CID 88619842
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 4-(4-octoxyphenyl)benzoate (PubChem CID 88619842) has the molecular formula C28H27F13O3 and a molecular weight of 658.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 4-(4-octoxyphenyl)benzoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 88619842 |
| Molecular Formula | C28H27F13O3 |
| Molecular Weight | 658.50 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H27F13O3/c1-2-3-4-5-6-7-16-43-21-14-12-19(13-15-21)18-8-10-20(11-9-18)22(42)44-17-23(29,30)24(31,32)25(33,34)26(35,36)27(37,38)28(39,40)41/h8-15H,2-7,16-17H2,1H3 |
| InChIKey | FMHCDFLZIJWKKA-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.50 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|